PHENOBARBITAL QUINIDINE

Product Code: 2226829
Molecular Formula:
Molecular Weight:
58693-19-9
69298-25-5 Benzyl 2,4-dichloropyrimidine-5-carboxylate
75214-68-5 sodium bis[4-[(5-chloro-2-hydroxyphenyl)azo]naphth[2,1-d]-1,3-oxathiazol-5-ol 3,3-dioxidato(2-)]chromate(2-)
69766-31-0 2-(1H-benzotriazol-1-yl)-N-(2-chloroethyl)-N-ethylethanaminium chloride
59710-71-3 tert-butyl tetradecaneperoxoate
694514-18-6 3-METHOXY-4-(TRIFLUOROMETHYL)BENZENESULFONYL CHLORIDE
70132-97-7 3-[4-(5-methyl-4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,2-benzisothiazole hydrochloride
693262-06-5 3-Piperidinecarboxylic acid, 1-methyl-4-phenyl-, ethyl ester,(3R,4S)-rel-
589491-14-5 1,4-Cyclohexanediamine,N-(7-chloro-4-quinolinyl)-N'-(3,5-dimethylphenyl)-, cis-
69291-24-3 4-oxo-2-phenyl-4H-3,1-benzoxathiine-8-carboxylic acid
69352-76-7 (2E,4E,8E,10E,14E,18E,20E)-20-(carboxymethyl)-6-methoxy-2,5,17-trimethyldocosa-2,4,8,10,14,18,20-heptaenedioic acid
211691-09-7 1-Tridecen-7-one
710973-27-6 1-Piperidinecarboxylic acid,4-[([1,1'-biphenyl]-2-ylmethyl)(cyclohexylmethyl)amino]-,1,1-dimethylethyl ester
71212-10-7 LOTOS 71
6944-91-8 S-methyl 2-(1,3-benzothiazol-2-yl)hydrazinecarbothioate
5949-36-0 5-ethyl-5-phenylbarbituric acid, compound with 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline (1:1)
58693-19-9 PHENOBARBITAL QUINIDINE
69352-81-4 1-{2-[(cyclohepta-2,4,6-trien-1-ylacetyl)oxy]ethyl}piperidinium chloride
841281-51-4 3-Piperidinecarboxamide,1-[4-cyano-6-[(2-methoxyphenyl)amino]-1,3,5-triazin-2-yl]-N,N-diethyl-
71213-91-7 9,10,10a,11a-tetrahydrobenzo[8,9]triphenyleno[1,2-b]oxirene-9,10-diol
58692-65-2 1-phenyl-1-(2-phenylcyclopropyl)ethanol