1,3-Propanediamine, N-(2-chloro-4-nitrophenyl)-
CAS No: 300668-01-3
Propane
300668-01-3
propanediamine,chloro,nitrophenyl,propane,300668-01-3
2025-10-17 Discover 1,3-Propanediamine, N-(2-chloro-4-nitrophenyl)- (CAS No: 300668-01-3) and related compounds. Ideal for advanced chemical applications. Competitive pricing, fast delivery, and expert support worldwide.