2-Benzoxazolamine, N-(4-bromophenyl)-5-chloro-

CAS No: 461699-46-7

461699-46-7
461699-46-7 benzoxazolamine,bromophenyl,chloro,benzoxazol,461699-46-7
2025-10-19 Discover 2-Benzoxazolamine, N-(4-bromophenyl)-5-chloro- (CAS No: 461699-46-7) and related compounds. Ideal for advanced chemical applications. Competitive pricing, fast delivery, and expert support worldwide.